About formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid
formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid (PubChem CID 171149675) has the molecular formula C14H24N2O5
and a molecular weight of 300.35 g/mol. Its IUPAC name is formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid.
Molecular Properties
| Compound Name | formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid |
| PubChem CID | 171149675 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid |
| SMILES | CCC=CCC(=O)NC1CCN(CC(=O)O)CC1.O=CO |
| InChI | InChI=1S/C13H22N2O3.CH2O2/c1-2-3-4-5-12(16)14-11-6-8-15(9-7-11)10-13(17)18;2-1-3/h3-4,11H,2,5-10H2,1H3,(H,14,16)(H,17,18);1H,(H,2,3) |
| InChIKey | WLHTYYQHUFVWEL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid?
The IUPAC name of formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid (CID 171149675) is formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid.
What is the SMILES notation for formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid?
The canonical SMILES for formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid is CCC=CCC(=O)NC1CCN(CC(=O)O)CC1.O=CO.
What is the InChIKey of formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid?
The InChIKey is WLHTYYQHUFVWEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3.CH2O2/c1-2-3-4-5-12(16)14-11-6-8-15(9-7-11)10-13(17)18;2-1-3/h3-4,11H,2,5-10H2,1H3,(H,14,16)(H,17,18);1H,(H,2,3).
What are the key properties of formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid?
formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid has a molecular weight of 300.35 g/mol, XLogP of 0.71, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;2-[4-(hex-3-enoylamino)piperidin-1-yl]acetic acid is sourced from PubChem (CID 171149675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).