About ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride
ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride (PubChem CID 171150102) has the molecular formula C16H31Cl2N3O4
and a molecular weight of 400.35 g/mol. Its IUPAC name is ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride.
Molecular Properties
| Compound Name | ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride |
| PubChem CID | 171150102 |
| Molecular Formula | C16H31Cl2N3O4 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)C1=CC(OC(CC)CC)C(NC(=O)CN)C(N)C1.Cl.Cl |
| InChI | InChI=1S/C16H29N3O4.2ClH/c1-4-11(5-2)23-13-8-10(16(21)22-6-3)7-12(18)15(13)19-14(20)9-17;;/h8,11-13,15H,4-7,9,17-18H2,1-3H3,(H,19,20);2*1H |
| InChIKey | JBFZEJHIFVNHGL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride?
The IUPAC name of ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride (CID 171150102) is ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride.
What is the SMILES notation for ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride?
The canonical SMILES for ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride is CCOC(=O)C1=CC(OC(CC)CC)C(NC(=O)CN)C(N)C1.Cl.Cl.
What is the InChIKey of ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride?
The InChIKey is JBFZEJHIFVNHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N3O4.2ClH/c1-4-11(5-2)23-13-8-10(16(21)22-6-3)7-12(18)15(13)19-14(20)9-17;;/h8,11-13,15H,4-7,9,17-18H2,1-3H3,(H,19,20);2*1H.
What are the key properties of ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride?
ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride has a molecular weight of 400.35 g/mol, XLogP of 1.07, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-amino-4-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;dihydrochloride is sourced from PubChem (CID 171150102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).