C19H27N3O4S — CID 171150198
1,4-dimethyl-7-(4-propan-2-ylphenyl)sulfonyl-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione (PubChem CID 171150198) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is 1,4-dimethyl-7-(4-propan-2-ylphenyl)sulfonyl-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione.
| Compound Name | 1,4-dimethyl-7-(4-propan-2-ylphenyl)sulfonyl-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione |
|---|---|
| PubChem CID | 171150198 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1,4-dimethyl-7-(4-propan-2-ylphenyl)sulfonyl-3,5a,6,8,9,9a-hexahydropyrido[4,3-e][1,4]diazepine-2,5-dione |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCC3C(C2)C(=O)N(C)CC(=O)N3C)cc1 |
| InChI | InChI=1S/C19H27N3O4S/c1-13(2)14-5-7-15(8-6-14)27(25,26)22-10-9-17-16(11-22)19(24)20(3)12-18(23)21(17)4/h5-8,13,16-17H,9-12H2,1-4H3 |
| InChIKey | SPKWWDFWGQULEF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |