C15H17N5O3 — CID 171150251
6-methyl-4-oxo-N-(2-phenoxyethyl)-6,7-dihydro-5H-triazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 171150251) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 6-methyl-4-oxo-N-(2-phenoxyethyl)-6,7-dihydro-5H-triazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | 6-methyl-4-oxo-N-(2-phenoxyethyl)-6,7-dihydro-5H-triazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 171150251 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 6-methyl-4-oxo-N-(2-phenoxyethyl)-6,7-dihydro-5H-triazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | CC1Cn2nnc(C(=O)NCCOc3ccccc3)c2C(=O)N1 |
| InChI | InChI=1S/C15H17N5O3/c1-10-9-20-13(15(22)17-10)12(18-19-20)14(21)16-7-8-23-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,16,21)(H,17,22) |
| InChIKey | RJGLOGVQYGCGJQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|