C17H22N4O6 — CID 171150767
but-2-enedioic acid;3-[4-(pyridine-3-carbonyl)piperazin-1-yl]propanamide (PubChem CID 171150767) has the molecular formula C17H22N4O6 and a molecular weight of 378.39 g/mol. Its IUPAC name is but-2-enedioic acid;3-[4-(pyridine-3-carbonyl)piperazin-1-yl]propanamide.
| Compound Name | but-2-enedioic acid;3-[4-(pyridine-3-carbonyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 171150767 |
| Molecular Formula | C17H22N4O6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | but-2-enedioic acid;3-[4-(pyridine-3-carbonyl)piperazin-1-yl]propanamide |
| SMILES | NC(=O)CCN1CCN(C(=O)c2cccnc2)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C13H18N4O2.C4H4O4/c14-12(18)3-5-16-6-8-17(9-7-16)13(19)11-2-1-4-15-10-11;5-3(6)1-2-4(7)8/h1-2,4,10H,3,5-9H2,(H2,14,18);1-2H,(H,5,6)(H,7,8) |
| InChIKey | PZKVEHCRLXQOKN-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 154.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|