C21H16ClFN4O3S — CID 171151170
1-(2-fluorophenyl)-5-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride (PubChem CID 171151170) has the molecular formula C21H16ClFN4O3S and a molecular weight of 458.90 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-5-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride.
| Compound Name | 1-(2-fluorophenyl)-5-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride |
|---|---|
| PubChem CID | 171151170 |
| Molecular Formula | C21H16ClFN4O3S |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 1-(2-fluorophenyl)-5-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione;hydrochloride |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1C=C1C(=O)NC(=S)N(c2ccccc2F)C1=O.Cl |
| InChI | InChI=1S/C21H15FN4O3S.ClH/c1-12-14(20(29)26(24-12)13-7-3-2-4-8-13)11-15-18(27)23-21(30)25(19(15)28)17-10-6-5-9-16(17)22;/h2-11,14H,1H3,(H,23,27,30);1H |
| InChIKey | RBYRGTKBWDZUHJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|