C28H35ClN2O5 — CID 171151629
4-[hydroxy-(4-methylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-propoxyphenyl)pyrrolidine-2,3-dione;hydrochloride (PubChem CID 171151629) has the molecular formula C28H35ClN2O5 and a molecular weight of 515.05 g/mol. Its IUPAC name is 4-[hydroxy-(4-methylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-propoxyphenyl)pyrrolidine-2,3-dione;hydrochloride.
| Compound Name | 4-[hydroxy-(4-methylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-propoxyphenyl)pyrrolidine-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 171151629 |
| Molecular Formula | C28H35ClN2O5 |
| Molecular Weight | 515.05 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 4-[hydroxy-(4-methylphenyl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-propoxyphenyl)pyrrolidine-2,3-dione;hydrochloride |
| SMILES | CCCOc1ccc(C2C(=C(O)c3ccc(C)cc3)C(=O)C(=O)N2CCCN2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C28H34N2O5.ClH/c1-3-17-35-23-11-9-21(10-12-23)25-24(26(31)22-7-5-20(2)6-8-22)27(32)28(33)30(25)14-4-13-29-15-18-34-19-16-29;/h5-12,25,31H,3-4,13-19H2,1-2H3;1H |
| InChIKey | GVRIAJBUXZYEOD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.05 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|