C16H27ClN2O2 — CID 171152294
cyclopent-3-en-1-yl-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]methanone;hydrochloride (PubChem CID 171152294) has the molecular formula C16H27ClN2O2 and a molecular weight of 314.86 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]methanone;hydrochloride.
| Compound Name | cyclopent-3-en-1-yl-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 171152294 |
| Molecular Formula | C16H27ClN2O2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | cyclopent-3-en-1-yl-[4-(methoxymethyl)-2,8-diazaspiro[4.5]decan-2-yl]methanone;hydrochloride |
| SMILES | COCC1CN(C(=O)C2CC=CC2)CC12CCNCC2.Cl |
| InChI | InChI=1S/C16H26N2O2.ClH/c1-20-11-14-10-18(15(19)13-4-2-3-5-13)12-16(14)6-8-17-9-7-16;/h2-3,13-14,17H,4-12H2,1H3;1H |
| InChIKey | YTBHGAZRXZEXGM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|