C32H31N5O3 — CID 171153065
21-methyl-3-[2-oxo-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one (PubChem CID 171153065) has the molecular formula C32H31N5O3 and a molecular weight of 533.63 g/mol. Its IUPAC name is 21-methyl-3-[2-oxo-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one.
| Compound Name | 21-methyl-3-[2-oxo-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one |
|---|---|
| PubChem CID | 171153065 |
| Molecular Formula | C32H31N5O3 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 21-methyl-3-[2-oxo-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one |
| SMILES | CN1c2ccccc2C(=O)N2CCc3c(n(CC(=O)N4CC5CC(C4)c4cccc(=O)n4C5)c4ccccc34)C21 |
| InChI | InChI=1S/C32H31N5O3/c1-33-26-9-4-3-8-24(26)32(40)35-14-13-23-22-7-2-5-10-27(22)37(30(23)31(33)35)19-29(39)34-16-20-15-21(18-34)25-11-6-12-28(38)36(25)17-20/h2-12,20-21,31H,13-19H2,1H3 |
| InChIKey | VOWFASZTQGXZPV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|