C24H29N3O2 — CID 171154216
11-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 171154216) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 11-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | 11-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 171154216 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 11-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)N2CC3CC(C2)C2CCCC(=O)N2C3)cc1 |
| InChI | InChI=1S/C24H29N3O2/c1-16-6-7-17(2)27(16)21-10-8-19(9-11-21)24(29)25-13-18-12-20(15-25)22-4-3-5-23(28)26(22)14-18/h6-11,18,20,22H,3-5,12-15H2,1-2H3 |
| InChIKey | CEYIINYPLRZEGC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|