C21H26ClFN4O3 — CID 171155556
N-[[(3S,7S,8aS)-7-acetamido-2-[(3-chloro-4-fluorophenyl)methyl]-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]cyclopropanecarboxamide (PubChem CID 171155556) has the molecular formula C21H26ClFN4O3 and a molecular weight of 436.92 g/mol. Its IUPAC name is N-[[(3S,7S,8aS)-7-acetamido-2-[(3-chloro-4-fluorophenyl)methyl]-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[(3S,7S,8aS)-7-acetamido-2-[(3-chloro-4-fluorophenyl)methyl]-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 171155556 |
| Molecular Formula | C21H26ClFN4O3 |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[[(3S,7S,8aS)-7-acetamido-2-[(3-chloro-4-fluorophenyl)methyl]-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]cyclopropanecarboxamide |
| SMILES | CC(=O)N[C@H]1C[C@H]2CN(Cc3ccc(F)c(Cl)c3)[C@@H](CNC(=O)C3CC3)C(=O)N2C1 |
| InChI | InChI=1S/C21H26ClFN4O3/c1-12(28)25-15-7-16-11-26(9-13-2-5-18(23)17(22)6-13)19(21(30)27(16)10-15)8-24-20(29)14-3-4-14/h2,5-6,14-16,19H,3-4,7-11H2,1H3,(H,24,29)(H,25,28)/t15-,16-,19-/m0/s1 |
| InChIKey | GTHKTRZPFJCPAE-BXWFABGCSA-N |
| XLogP | 1.30 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |