C23H32FN5O3 — CID 171155588
N-[[(3S,7S,8aS)-2-[(4-fluorophenyl)methyl]-4-oxo-7-(propan-2-ylcarbamoylamino)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]cyclopropanecarboxamide (PubChem CID 171155588) has the molecular formula C23H32FN5O3 and a molecular weight of 445.54 g/mol. Its IUPAC name is N-[[(3S,7S,8aS)-2-[(4-fluorophenyl)methyl]-4-oxo-7-(propan-2-ylcarbamoylamino)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[(3S,7S,8aS)-2-[(4-fluorophenyl)methyl]-4-oxo-7-(propan-2-ylcarbamoylamino)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 171155588 |
| Molecular Formula | C23H32FN5O3 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-[[(3S,7S,8aS)-2-[(4-fluorophenyl)methyl]-4-oxo-7-(propan-2-ylcarbamoylamino)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]cyclopropanecarboxamide |
| SMILES | CC(C)NC(=O)N[C@H]1C[C@H]2CN(Cc3ccc(F)cc3)[C@@H](CNC(=O)C3CC3)C(=O)N2C1 |
| InChI | InChI=1S/C23H32FN5O3/c1-14(2)26-23(32)27-18-9-19-13-28(11-15-3-7-17(24)8-4-15)20(22(31)29(19)12-18)10-25-21(30)16-5-6-16/h3-4,7-8,14,16,18-20H,5-6,9-13H2,1-2H3,(H,25,30)(H2,26,27,32)/t18-,19-,20-/m0/s1 |
| InChIKey | HDWHKAJYCCOVEC-UFYCRDLUSA-N |
| XLogP | 1.21 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |