C19H30N4O2 — CID 171155865
1-[4-[(3aS,5S,6S,7aR)-5-hydroxy-6-(2-methylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]piperidin-1-yl]ethanone (PubChem CID 171155865) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-[4-[(3aS,5S,6S,7aR)-5-hydroxy-6-(2-methylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3aS,5S,6S,7aR)-5-hydroxy-6-(2-methylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 171155865 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-[4-[(3aS,5S,6S,7aR)-5-hydroxy-6-(2-methylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(N2C[C@H]3C[C@H](O)[C@@H](n4ccnc4C)C[C@H]3C2)CC1 |
| InChI | InChI=1S/C19H30N4O2/c1-13-20-5-8-23(13)18-9-15-11-22(12-16(15)10-19(18)25)17-3-6-21(7-4-17)14(2)24/h5,8,15-19,25H,3-4,6-7,9-12H2,1-2H3/t15-,16+,18-,19-/m0/s1 |
| InChIKey | PLSIMGUVFLMLCJ-NBMJBFSESA-N |
| XLogP | 1.45 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |