C22H25FN4OS — CID 171156152
2-[[(3aS,5S,6S,7aR)-5-(2-fluorophenoxy)-6-(2-methylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1,3-thiazole (PubChem CID 171156152) has the molecular formula C22H25FN4OS and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[[(3aS,5S,6S,7aR)-5-(2-fluorophenoxy)-6-(2-methylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(3aS,5S,6S,7aR)-5-(2-fluorophenoxy)-6-(2-methylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 171156152 |
| Molecular Formula | C22H25FN4OS |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-[[(3aS,5S,6S,7aR)-5-(2-fluorophenoxy)-6-(2-methylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1,3-thiazole |
| SMILES | Cc1nccn1[C@H]1C[C@H]2CN(Cc3nccs3)C[C@H]2C[C@@H]1Oc1ccccc1F |
| InChI | InChI=1S/C22H25FN4OS/c1-15-24-6-8-27(15)19-10-16-12-26(14-22-25-7-9-29-22)13-17(16)11-21(19)28-20-5-3-2-4-18(20)23/h2-9,16-17,19,21H,10-14H2,1H3/t16-,17+,19-,21-/m0/s1 |
| InChIKey | QLNNXPKYVWQRHB-NZGUISNBSA-N |
| XLogP | 4.32 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |