C28H29ClN2O7 — CID 171156852
4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(pyridin-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride (PubChem CID 171156852) has the molecular formula C28H29ClN2O7 and a molecular weight of 541.00 g/mol. Its IUPAC name is 4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(pyridin-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride.
| Compound Name | 4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(pyridin-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 171156852 |
| Molecular Formula | C28H29ClN2O7 |
| Molecular Weight | 541.00 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(pyridin-3-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(Cc3cccnc3)C2c2cc(OC)c(OC)c(OC)c2)cc1C.Cl |
| InChI | InChI=1S/C28H28N2O7.ClH/c1-16-11-18(8-9-20(16)34-2)25(31)23-24(19-12-21(35-3)27(37-5)22(13-19)36-4)30(28(33)26(23)32)15-17-7-6-10-29-14-17;/h6-14,24,31H,15H2,1-5H3;1H |
| InChIKey | OJUMFUVREFFJPH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.00 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|