C39H56O3 — CID 171156988
[(4R,5R,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] 3-phenylprop-2-enoate (PubChem CID 171156988) has the molecular formula C39H56O3 and a molecular weight of 572.87 g/mol. Its IUPAC name is [(4R,5R,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] 3-phenylprop-2-enoate.
| Compound Name | [(4R,5R,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 171156988 |
| Molecular Formula | C39H56O3 |
| Molecular Weight | 572.87 g/mol |
| Exact Mass | 572.42 |
| IUPAC Name | [(4R,5R,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] 3-phenylprop-2-enoate |
| SMILES | CC1(C)CCC23CC[C@]4(C)C(CCC5[C@@]6(C)CCC(OC(=O)C=Cc7ccccc7)C(C)(C)C6CC[C@]54C)C2C1OC3 |
| InChI | InChI=1S/C39H56O3/c1-34(2)21-23-39-24-22-37(6)27(32(39)33(34)41-25-39)14-15-29-36(5)19-18-30(35(3,4)28(36)17-20-38(29,37)7)42-31(40)16-13-26-11-9-8-10-12-26/h8-13,16,27-30,32-33H,14-15,17-25H2,1-7H3/t27?,28?,29?,30?,32?,33?,36-,37+,38+,39?/m0/s1 |
| InChIKey | HCPKDTDRKGFKRC-AKJMBXGCSA-N |
| XLogP | 9.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.87 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|