About (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride
(1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride (PubChem CID 171157465) has the molecular formula C6H14ClN5
and a molecular weight of 191.67 g/mol. Its IUPAC name is (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride |
| PubChem CID | 171157465 |
| Molecular Formula | C6H14ClN5 |
| Molecular Weight | 191.67 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride |
| SMILES | CC(C)(C)[C@@H](N)c1nn[nH]n1.Cl |
| InChI | InChI=1S/C6H13N5.ClH/c1-6(2,3)4(7)5-8-10-11-9-5;/h4H,7H2,1-3H3,(H,8,9,10,11);1H/t4-;/m0./s1 |
| InChIKey | KCFIORMTWFHGTJ-WCCKRBBISA-N |
| XLogP | 0.67 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.67 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride?
The IUPAC name of (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride (CID 171157465) is (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride.
What is the SMILES notation for (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride?
The canonical SMILES for (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride is CC(C)(C)[C@@H](N)c1nn[nH]n1.Cl.
What is the InChIKey of (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride?
The InChIKey is KCFIORMTWFHGTJ-WCCKRBBISA-N. The full InChI is InChI=1S/C6H13N5.ClH/c1-6(2,3)4(7)5-8-10-11-9-5;/h4H,7H2,1-3H3,(H,8,9,10,11);1H/t4-;/m0./s1.
What are the key properties of (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride?
(1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride has a molecular weight of 191.67 g/mol, XLogP of 0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propan-1-amine;hydrochloride is sourced from PubChem (CID 171157465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).