About 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene
2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene (PubChem CID 171157622) has the molecular formula C11H14BrF2O3P
and a molecular weight of 343.10 g/mol. Its IUPAC name is 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene.
Molecular Properties
| Compound Name | 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene |
| PubChem CID | 171157622 |
| Molecular Formula | C11H14BrF2O3P |
| Molecular Weight | 343.10 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene |
| SMILES | CCOP(=O)(Cc1ccc(F)c(F)c1Br)OCC |
| InChI | InChI=1S/C11H14BrF2O3P/c1-3-16-18(15,17-4-2)7-8-5-6-9(13)11(14)10(8)12/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | JOMIVBXETCXYLY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.10 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene?
The IUPAC name of 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene (CID 171157622) is 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene.
What is the SMILES notation for 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene?
The canonical SMILES for 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene is CCOP(=O)(Cc1ccc(F)c(F)c1Br)OCC.
What is the InChIKey of 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene?
The InChIKey is JOMIVBXETCXYLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrF2O3P/c1-3-16-18(15,17-4-2)7-8-5-6-9(13)11(14)10(8)12/h5-6H,3-4,7H2,1-2H3.
What are the key properties of 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene?
2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene has a molecular weight of 343.10 g/mol, XLogP of 4.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(diethoxyphosphorylmethyl)-3,4-difluorobenzene is sourced from PubChem (CID 171157622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).