C13H19NO — CID 171157804
(1S,5R)-6,6-dimethyl-2-[1-(prop-2-enylamino)ethylidene]bicyclo[3.1.0]hexan-3-one (PubChem CID 171157804) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (1S,5R)-6,6-dimethyl-2-[1-(prop-2-enylamino)ethylidene]bicyclo[3.1.0]hexan-3-one.
| Compound Name | (1S,5R)-6,6-dimethyl-2-[1-(prop-2-enylamino)ethylidene]bicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 171157804 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (1S,5R)-6,6-dimethyl-2-[1-(prop-2-enylamino)ethylidene]bicyclo[3.1.0]hexan-3-one |
| SMILES | C=CCNC(C)=C1C(=O)C[C@@H]2[C@H]1C2(C)C |
| InChI | InChI=1S/C13H19NO/c1-5-6-14-8(2)11-10(15)7-9-12(11)13(9,3)4/h5,9,12,14H,1,6-7H2,2-4H3/t9-,12-/m1/s1 |
| InChIKey | KCPGFMKOFUYKNY-BXKDBHETSA-N |
| XLogP | 2.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|