C14H22N6O3S — CID 171159164
N-[(1R,2R,5S)-5-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-hydroxycyclohexyl]-1-methylpyrazole-4-sulfonamide (PubChem CID 171159164) has the molecular formula C14H22N6O3S and a molecular weight of 354.44 g/mol. Its IUPAC name is N-[(1R,2R,5S)-5-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-hydroxycyclohexyl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[(1R,2R,5S)-5-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-hydroxycyclohexyl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 171159164 |
| Molecular Formula | C14H22N6O3S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[(1R,2R,5S)-5-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-hydroxycyclohexyl]-1-methylpyrazole-4-sulfonamide |
| SMILES | Cc1nc([C@H]2CC[C@@H](O)[C@H](NS(=O)(=O)c3cnn(C)c3)C2)n(C)n1 |
| InChI | InChI=1S/C14H22N6O3S/c1-9-16-14(20(3)17-9)10-4-5-13(21)12(6-10)18-24(22,23)11-7-15-19(2)8-11/h7-8,10,12-13,18,21H,4-6H2,1-3H3/t10-,12+,13+/m0/s1 |
| InChIKey | USSURPZCLKXLFM-CYZMBNFOSA-N |
| XLogP | -0.17 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |