C16H26F2N4O — CID 171159229
(1R,2R,4S)-2-[(4,4-difluorocyclohexyl)amino]-4-(2,5-dimethyl-1,2,4-triazol-3-yl)cyclohexan-1-ol (PubChem CID 171159229) has the molecular formula C16H26F2N4O and a molecular weight of 328.41 g/mol. Its IUPAC name is (1R,2R,4S)-2-[(4,4-difluorocyclohexyl)amino]-4-(2,5-dimethyl-1,2,4-triazol-3-yl)cyclohexan-1-ol.
| Compound Name | (1R,2R,4S)-2-[(4,4-difluorocyclohexyl)amino]-4-(2,5-dimethyl-1,2,4-triazol-3-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 171159229 |
| Molecular Formula | C16H26F2N4O |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (1R,2R,4S)-2-[(4,4-difluorocyclohexyl)amino]-4-(2,5-dimethyl-1,2,4-triazol-3-yl)cyclohexan-1-ol |
| SMILES | Cc1nc([C@H]2CC[C@@H](O)[C@H](NC3CCC(F)(F)CC3)C2)n(C)n1 |
| InChI | InChI=1S/C16H26F2N4O/c1-10-19-15(22(2)21-10)11-3-4-14(23)13(9-11)20-12-5-7-16(17,18)8-6-12/h11-14,20,23H,3-9H2,1-2H3/t11-,13+,14+/m0/s1 |
| InChIKey | ACYLFFYBCLBZJW-IACUBPJLSA-N |
| XLogP | 2.29 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |