C15H20F3NO — CID 171160385
(1S,2R)-2-amino-1-cyclohexyl-2-[4-(trifluoromethyl)phenyl]ethanol (PubChem CID 171160385) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclohexyl-2-[4-(trifluoromethyl)phenyl]ethanol.
| Compound Name | (1S,2R)-2-amino-1-cyclohexyl-2-[4-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 171160385 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclohexyl-2-[4-(trifluoromethyl)phenyl]ethanol |
| SMILES | N[C@H](c1ccc(C(F)(F)F)cc1)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C15H20F3NO/c16-15(17,18)12-8-6-10(7-9-12)13(19)14(20)11-4-2-1-3-5-11/h6-9,11,13-14,20H,1-5,19H2/t13-,14+/m1/s1 |
| InChIKey | PLEVZMLURIWQGR-KGLIPLIRSA-N |
| XLogP | 3.65 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |