C15H23NO — CID 171162391
(1R,2S)-2-amino-1-cyclobutyl-2-(4-propan-2-ylphenyl)ethanol (PubChem CID 171162391) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-cyclobutyl-2-(4-propan-2-ylphenyl)ethanol.
| Compound Name | (1R,2S)-2-amino-1-cyclobutyl-2-(4-propan-2-ylphenyl)ethanol |
|---|---|
| PubChem CID | 171162391 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (1R,2S)-2-amino-1-cyclobutyl-2-(4-propan-2-ylphenyl)ethanol |
| SMILES | CC(C)c1ccc([C@H](N)[C@H](O)C2CCC2)cc1 |
| InChI | InChI=1S/C15H23NO/c1-10(2)11-6-8-12(9-7-11)14(16)15(17)13-4-3-5-13/h6-10,13-15,17H,3-5,16H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | BDGPKLMMTFBZOX-LSDHHAIUSA-N |
| XLogP | 2.97 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |