C14H17BrF4N2 — CID 171163352
1-[(1S)-1-(3-bromo-4-fluorophenyl)-4,4,4-trifluorobutyl]piperazine (PubChem CID 171163352) has the molecular formula C14H17BrF4N2 and a molecular weight of 369.20 g/mol. Its IUPAC name is 1-[(1S)-1-(3-bromo-4-fluorophenyl)-4,4,4-trifluorobutyl]piperazine.
| Compound Name | 1-[(1S)-1-(3-bromo-4-fluorophenyl)-4,4,4-trifluorobutyl]piperazine |
|---|---|
| PubChem CID | 171163352 |
| Molecular Formula | C14H17BrF4N2 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 1-[(1S)-1-(3-bromo-4-fluorophenyl)-4,4,4-trifluorobutyl]piperazine |
| SMILES | Fc1ccc([C@H](CCC(F)(F)F)N2CCNCC2)cc1Br |
| InChI | InChI=1S/C14H17BrF4N2/c15-11-9-10(1-2-12(11)16)13(3-4-14(17,18)19)21-7-5-20-6-8-21/h1-2,9,13,20H,3-8H2/t13-/m0/s1 |
| InChIKey | LLIJUAHHDNHXNY-ZDUSSCGKSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |