C13H15BrF4N2 — CID 171163773
1-[(1S)-1-(2-bromo-5-fluorophenyl)-3,3,3-trifluoropropyl]piperazine (PubChem CID 171163773) has the molecular formula C13H15BrF4N2 and a molecular weight of 355.17 g/mol. Its IUPAC name is 1-[(1S)-1-(2-bromo-5-fluorophenyl)-3,3,3-trifluoropropyl]piperazine.
| Compound Name | 1-[(1S)-1-(2-bromo-5-fluorophenyl)-3,3,3-trifluoropropyl]piperazine |
|---|---|
| PubChem CID | 171163773 |
| Molecular Formula | C13H15BrF4N2 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1-[(1S)-1-(2-bromo-5-fluorophenyl)-3,3,3-trifluoropropyl]piperazine |
| SMILES | Fc1ccc(Br)c([C@H](CC(F)(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C13H15BrF4N2/c14-11-2-1-9(15)7-10(11)12(8-13(16,17)18)20-5-3-19-4-6-20/h1-2,7,12,19H,3-6,8H2/t12-/m0/s1 |
| InChIKey | JRDRKOUMSWIJHK-LBPRGKRZSA-N |
| XLogP | 3.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |