About 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride
4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride (PubChem CID 171163908) has the molecular formula C14H19BrClF3N2O
and a molecular weight of 403.67 g/mol. Its IUPAC name is 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride.
Molecular Properties
| Compound Name | 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride |
| PubChem CID | 171163908 |
| Molecular Formula | C14H19BrClF3N2O |
| Molecular Weight | 403.67 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(Br)c([C@H](CCC(F)(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C14H18BrF3N2O.ClH/c15-12-2-1-10(21)9-11(12)13(3-4-14(16,17)18)20-7-5-19-6-8-20;/h1-2,9,13,19,21H,3-8H2;1H/t13-;/m0./s1 |
| InChIKey | ATQVSAGMXDHYDG-ZOWNYOTGSA-N |
| XLogP | 3.87 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride?
The IUPAC name of 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride (CID 171163908) is 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride.
What is the SMILES notation for 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride?
The canonical SMILES for 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride is Cl.Oc1ccc(Br)c([C@H](CCC(F)(F)F)N2CCNCC2)c1.
What is the InChIKey of 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride?
The InChIKey is ATQVSAGMXDHYDG-ZOWNYOTGSA-N. The full InChI is InChI=1S/C14H18BrF3N2O.ClH/c15-12-2-1-10(21)9-11(12)13(3-4-14(16,17)18)20-7-5-19-6-8-20;/h1-2,9,13,19,21H,3-8H2;1H/t13-;/m0./s1.
What are the key properties of 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride?
4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride has a molecular weight of 403.67 g/mol, XLogP of 3.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride is sourced from PubChem (CID 171163908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).