About 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol
4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol (PubChem CID 171163911) has the molecular formula C13H16BrF3N2O
and a molecular weight of 353.18 g/mol. Its IUPAC name is 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol.
Molecular Properties
| Compound Name | 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol |
| PubChem CID | 171163911 |
| Molecular Formula | C13H16BrF3N2O |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol |
| SMILES | Oc1ccc(Br)c([C@H](CC(F)(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C13H16BrF3N2O/c14-11-2-1-9(20)7-10(11)12(8-13(15,16)17)19-5-3-18-4-6-19/h1-2,7,12,18,20H,3-6,8H2/t12-/m0/s1 |
| InChIKey | AXKJIPBCQJFSSS-LBPRGKRZSA-N |
| XLogP | 3.05 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol?
The IUPAC name of 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol (CID 171163911) is 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol.
What is the SMILES notation for 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol?
The canonical SMILES for 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol is Oc1ccc(Br)c([C@H](CC(F)(F)F)N2CCNCC2)c1.
What is the InChIKey of 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol?
The InChIKey is AXKJIPBCQJFSSS-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H16BrF3N2O/c14-11-2-1-9(20)7-10(11)12(8-13(15,16)17)19-5-3-18-4-6-19/h1-2,7,12,18,20H,3-6,8H2/t12-/m0/s1.
What are the key properties of 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol?
4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol has a molecular weight of 353.18 g/mol, XLogP of 3.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol is sourced from PubChem (CID 171163911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).