C15H24ClFN2O — CID 171168266
2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-4-fluorophenol;hydrochloride (PubChem CID 171168266) has the molecular formula C15H24ClFN2O and a molecular weight of 302.82 g/mol. Its IUPAC name is 2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-4-fluorophenol;hydrochloride.
| Compound Name | 2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-4-fluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171168266 |
| Molecular Formula | C15H24ClFN2O |
| Molecular Weight | 302.82 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[(1R)-2,2-dimethyl-1-piperazin-1-ylpropyl]-4-fluorophenol;hydrochloride |
| SMILES | CC(C)(C)[C@H](c1cc(F)ccc1O)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H23FN2O.ClH/c1-15(2,3)14(18-8-6-17-7-9-18)12-10-11(16)4-5-13(12)19;/h4-5,10,14,17,19H,6-9H2,1-3H3;1H/t14-;/m0./s1 |
| InChIKey | VROVNIXTZDCQPA-UQKRIMTDSA-N |
| XLogP | 2.95 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.82 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|