C15H21BrClFN2 — CID 171168952
1-[(1R)-1-(4-bromo-3-fluorophenyl)-2-cyclopropylethyl]piperazine;hydrochloride (PubChem CID 171168952) has the molecular formula C15H21BrClFN2 and a molecular weight of 363.70 g/mol. Its IUPAC name is 1-[(1R)-1-(4-bromo-3-fluorophenyl)-2-cyclopropylethyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(4-bromo-3-fluorophenyl)-2-cyclopropylethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171168952 |
| Molecular Formula | C15H21BrClFN2 |
| Molecular Weight | 363.70 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-[(1R)-1-(4-bromo-3-fluorophenyl)-2-cyclopropylethyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1cc([C@@H](CC2CC2)N2CCNCC2)ccc1Br |
| InChI | InChI=1S/C15H20BrFN2.ClH/c16-13-4-3-12(10-14(13)17)15(9-11-1-2-11)19-7-5-18-6-8-19;/h3-4,10-11,15,18H,1-2,5-9H2;1H/t15-;/m1./s1 |
| InChIKey | VTEWXLFJERRHKR-XFULWGLBSA-N |
| XLogP | 3.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.70 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |