C13H17ClF2N2 — CID 171169195
1-[(1R)-1-(4-chloro-2-fluorophenyl)-3-fluoropropyl]piperazine (PubChem CID 171169195) has the molecular formula C13H17ClF2N2 and a molecular weight of 274.74 g/mol. Its IUPAC name is 1-[(1R)-1-(4-chloro-2-fluorophenyl)-3-fluoropropyl]piperazine.
| Compound Name | 1-[(1R)-1-(4-chloro-2-fluorophenyl)-3-fluoropropyl]piperazine |
|---|---|
| PubChem CID | 171169195 |
| Molecular Formula | C13H17ClF2N2 |
| Molecular Weight | 274.74 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-[(1R)-1-(4-chloro-2-fluorophenyl)-3-fluoropropyl]piperazine |
| SMILES | FCC[C@H](c1ccc(Cl)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C13H17ClF2N2/c14-10-1-2-11(12(16)9-10)13(3-4-15)18-7-5-17-6-8-18/h1-2,9,13,17H,3-8H2/t13-/m1/s1 |
| InChIKey | ZDBBNNAYDJNTKA-CYBMUJFWSA-N |
| XLogP | 2.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.74 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |