About 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol
4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol (PubChem CID 171169274) has the molecular formula C14H18BrF3N2O
and a molecular weight of 367.21 g/mol. Its IUPAC name is 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol.
Molecular Properties
| Compound Name | 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
| PubChem CID | 171169274 |
| Molecular Formula | C14H18BrF3N2O |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
| SMILES | Oc1ccc(Br)c([C@@H](CCC(F)(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C14H18BrF3N2O/c15-12-2-1-10(21)9-11(12)13(3-4-14(16,17)18)20-7-5-19-6-8-20/h1-2,9,13,19,21H,3-8H2/t13-/m1/s1 |
| InChIKey | YDUDFNGVAGNPHQ-CYBMUJFWSA-N |
| XLogP | 3.44 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol?
The IUPAC name of 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol (CID 171169274) is 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol.
What is the SMILES notation for 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol?
The canonical SMILES for 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol is Oc1ccc(Br)c([C@@H](CCC(F)(F)F)N2CCNCC2)c1.
What is the InChIKey of 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol?
The InChIKey is YDUDFNGVAGNPHQ-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H18BrF3N2O/c15-12-2-1-10(21)9-11(12)13(3-4-14(16,17)18)20-7-5-19-6-8-20/h1-2,9,13,19,21H,3-8H2/t13-/m1/s1.
What are the key properties of 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol?
4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol has a molecular weight of 367.21 g/mol, XLogP of 3.44, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol is sourced from PubChem (CID 171169274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).