About 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride
4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride (PubChem CID 171169283) has the molecular formula C13H17BrClF3N2O
and a molecular weight of 389.64 g/mol. Its IUPAC name is 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride.
Molecular Properties
| Compound Name | 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride |
| PubChem CID | 171169283 |
| Molecular Formula | C13H17BrClF3N2O |
| Molecular Weight | 389.64 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(Br)c([C@@H](CC(F)(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C13H16BrF3N2O.ClH/c14-11-2-1-9(20)7-10(11)12(8-13(15,16)17)19-5-3-18-4-6-19;/h1-2,7,12,18,20H,3-6,8H2;1H/t12-;/m1./s1 |
| InChIKey | IUWAWHUOFKOSTA-UTONKHPSSA-N |
| XLogP | 3.48 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride?
The IUPAC name of 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride (CID 171169283) is 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride.
What is the SMILES notation for 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride?
The canonical SMILES for 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride is Cl.Oc1ccc(Br)c([C@@H](CC(F)(F)F)N2CCNCC2)c1.
What is the InChIKey of 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride?
The InChIKey is IUWAWHUOFKOSTA-UTONKHPSSA-N. The full InChI is InChI=1S/C13H16BrF3N2O.ClH/c14-11-2-1-9(20)7-10(11)12(8-13(15,16)17)19-5-3-18-4-6-19;/h1-2,7,12,18,20H,3-6,8H2;1H/t12-;/m1./s1.
What are the key properties of 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride?
4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride has a molecular weight of 389.64 g/mol, XLogP of 3.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride is sourced from PubChem (CID 171169283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).