C17H23ClF4N2 — CID 171172374
1-[(R)-cyclopentyl-[3-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171172374) has the molecular formula C17H23ClF4N2 and a molecular weight of 366.83 g/mol. Its IUPAC name is 1-[(R)-cyclopentyl-[3-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(R)-cyclopentyl-[3-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171172374 |
| Molecular Formula | C17H23ClF4N2 |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[(R)-cyclopentyl-[3-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1cccc([C@@H](C2CCCC2)N2CCNCC2)c1C(F)(F)F |
| InChI | InChI=1S/C17H22F4N2.ClH/c18-14-7-3-6-13(15(14)17(19,20)21)16(12-4-1-2-5-12)23-10-8-22-9-11-23;/h3,6-7,12,16,22H,1-2,4-5,8-11H2;1H/t16-;/m1./s1 |
| InChIKey | KJIIQCQXYJPMQZ-PKLMIRHRSA-N |
| XLogP | 4.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |