C15H20ClF3N2 — CID 171172615
1-[(1R)-1-(4-chloro-2-methylphenyl)-4,4,4-trifluorobutyl]piperazine (PubChem CID 171172615) has the molecular formula C15H20ClF3N2 and a molecular weight of 320.79 g/mol. Its IUPAC name is 1-[(1R)-1-(4-chloro-2-methylphenyl)-4,4,4-trifluorobutyl]piperazine.
| Compound Name | 1-[(1R)-1-(4-chloro-2-methylphenyl)-4,4,4-trifluorobutyl]piperazine |
|---|---|
| PubChem CID | 171172615 |
| Molecular Formula | C15H20ClF3N2 |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[(1R)-1-(4-chloro-2-methylphenyl)-4,4,4-trifluorobutyl]piperazine |
| SMILES | Cc1cc(Cl)ccc1[C@@H](CCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C15H20ClF3N2/c1-11-10-12(16)2-3-13(11)14(4-5-15(17,18)19)21-8-6-20-7-9-21/h2-3,10,14,20H,4-9H2,1H3/t14-/m1/s1 |
| InChIKey | QXAQIFOZHUWJQQ-CQSZACIVSA-N |
| XLogP | 3.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |