C15H18ClF3N2O2 — CID 171172809
1-[(1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-4,4,4-trifluorobutyl]piperazine (PubChem CID 171172809) has the molecular formula C15H18ClF3N2O2 and a molecular weight of 350.77 g/mol. Its IUPAC name is 1-[(1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-4,4,4-trifluorobutyl]piperazine.
| Compound Name | 1-[(1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-4,4,4-trifluorobutyl]piperazine |
|---|---|
| PubChem CID | 171172809 |
| Molecular Formula | C15H18ClF3N2O2 |
| Molecular Weight | 350.77 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-[(1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-4,4,4-trifluorobutyl]piperazine |
| SMILES | FC(F)(F)CC[C@H](c1cc2c(cc1Cl)OCO2)N1CCNCC1 |
| InChI | InChI=1S/C15H18ClF3N2O2/c16-11-8-14-13(22-9-23-14)7-10(11)12(1-2-15(17,18)19)21-5-3-20-4-6-21/h7-8,12,20H,1-6,9H2/t12-/m1/s1 |
| InChIKey | GMPSUERFNPLAKL-GFCCVEGCSA-N |
| XLogP | 3.36 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |