About 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride
2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride (PubChem CID 171172998) has the molecular formula C15H21Cl2F3N2O2
and a molecular weight of 389.25 g/mol. Its IUPAC name is 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride |
| PubChem CID | 171172998 |
| Molecular Formula | C15H21Cl2F3N2O2 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride |
| SMILES | COc1cc([C@@H](CCC(F)(F)F)N2CCNCC2)cc(Cl)c1O.Cl |
| InChI | InChI=1S/C15H20ClF3N2O2.ClH/c1-23-13-9-10(8-11(16)14(13)22)12(2-3-15(17,18)19)21-6-4-20-5-7-21;/h8-9,12,20,22H,2-7H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | HXCAGRLCRLFOMG-UTONKHPSSA-N |
| XLogP | 3.76 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride?
The IUPAC name of 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride (CID 171172998) is 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride.
What is the SMILES notation for 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride?
The canonical SMILES for 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride is COc1cc([C@@H](CCC(F)(F)F)N2CCNCC2)cc(Cl)c1O.Cl.
What is the InChIKey of 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride?
The InChIKey is HXCAGRLCRLFOMG-UTONKHPSSA-N. The full InChI is InChI=1S/C15H20ClF3N2O2.ClH/c1-23-13-9-10(8-11(16)14(13)22)12(2-3-15(17,18)19)21-6-4-20-5-7-21;/h8-9,12,20,22H,2-7H2,1H3;1H/t12-;/m1./s1.
What are the key properties of 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride?
2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride has a molecular weight of 389.25 g/mol, XLogP of 3.76, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-methoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol;hydrochloride is sourced from PubChem (CID 171172998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).