C13H17F3N2O2 — CID 171175024
2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-6-fluorophenol (PubChem CID 171175024) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-6-fluorophenol.
| Compound Name | 2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-6-fluorophenol |
|---|---|
| PubChem CID | 171175024 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-6-fluorophenol |
| SMILES | OCC(F)(F)[C@H](c1cccc(F)c1O)N1CCNCC1 |
| InChI | InChI=1S/C13H17F3N2O2/c14-10-3-1-2-9(11(10)20)12(13(15,16)8-19)18-6-4-17-5-7-18/h1-3,12,17,19-20H,4-8H2/t12-/m0/s1 |
| InChIKey | JESDCFODDYLTQE-LBPRGKRZSA-N |
| XLogP | 1.11 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|