C5H8N4O — CID 17118319
3-amino-1-methylpyrazole-4-carboxamide (PubChem CID 17118319) has the molecular formula C5H8N4O and a molecular weight of 140.15 g/mol. Its IUPAC name is 3-amino-1-methylpyrazole-4-carboxamide.
| Compound Name | 3-amino-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 17118319 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 3-amino-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(N)=O)c(N)n1 |
| InChI | InChI=1S/C5H8N4O/c1-9-2-3(5(7)10)4(6)8-9/h2H,1H3,(H2,6,8)(H2,7,10) |
| InChIKey | AFVDRBOAZKXVQB-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |