C28H24N2O2S — CID 17118340
2-(2-methoxyphenyl)-10-(4-methylphenyl)-1-sulfanylidene-3a,4,9,10-tetrahydroindolizino[6,7-b]indol-3-one (PubChem CID 17118340) has the molecular formula C28H24N2O2S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-10-(4-methylphenyl)-1-sulfanylidene-3a,4,9,10-tetrahydroindolizino[6,7-b]indol-3-one.
| Compound Name | 2-(2-methoxyphenyl)-10-(4-methylphenyl)-1-sulfanylidene-3a,4,9,10-tetrahydroindolizino[6,7-b]indol-3-one |
|---|---|
| PubChem CID | 17118340 |
| Molecular Formula | C28H24N2O2S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-(2-methoxyphenyl)-10-(4-methylphenyl)-1-sulfanylidene-3a,4,9,10-tetrahydroindolizino[6,7-b]indol-3-one |
| SMILES | COc1ccccc1C1C(=O)C2Cc3c([nH]c4ccccc34)C(c3ccc(C)cc3)N2C1=S |
| InChI | InChI=1S/C28H24N2O2S/c1-16-11-13-17(14-12-16)26-25-20(18-7-3-5-9-21(18)29-25)15-22-27(31)24(28(33)30(22)26)19-8-4-6-10-23(19)32-2/h3-14,22,24,26,29H,15H2,1-2H3 |
| InChIKey | CBEMFFIPAARHSN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|