C9H7ClF3NO2 — CID 171183884
(4S)-4-(2,3,5-trifluorophenyl)-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 171183884) has the molecular formula C9H7ClF3NO2 and a molecular weight of 253.61 g/mol. Its IUPAC name is (4S)-4-(2,3,5-trifluorophenyl)-1,3-oxazolidin-2-one;hydrochloride.
| Compound Name | (4S)-4-(2,3,5-trifluorophenyl)-1,3-oxazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 171183884 |
| Molecular Formula | C9H7ClF3NO2 |
| Molecular Weight | 253.61 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | (4S)-4-(2,3,5-trifluorophenyl)-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@@H](c2cc(F)cc(F)c2F)CO1 |
| InChI | InChI=1S/C9H6F3NO2.ClH/c10-4-1-5(8(12)6(11)2-4)7-3-15-9(14)13-7;/h1-2,7H,3H2,(H,13,14);1H/t7-;/m1./s1 |
| InChIKey | GLPUTBXAQSIDEC-OGFXRTJISA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.61 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|