About (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride
(4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 171184730) has the molecular formula C9H10ClNO2
and a molecular weight of 199.64 g/mol. Its IUPAC name is (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride |
| PubChem CID | 171184730 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C9H9NO2.ClH/c11-9-10-8(6-12-9)7-4-2-1-3-5-7;/h1-5,8H,6H2,(H,10,11);1H/t8-;/m0./s1 |
| InChIKey | UVUJZPYOBRUBFC-QRPNPIFTSA-N |
| XLogP | 1.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride?
The IUPAC name of (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride (CID 171184730) is (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride.
What is the SMILES notation for (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride?
The canonical SMILES for (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride is Cl.O=C1N[C@H](c2ccccc2)CO1.
What is the InChIKey of (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride?
The InChIKey is UVUJZPYOBRUBFC-QRPNPIFTSA-N. The full InChI is InChI=1S/C9H9NO2.ClH/c11-9-10-8(6-12-9)7-4-2-1-3-5-7;/h1-5,8H,6H2,(H,10,11);1H/t8-;/m0./s1.
What are the key properties of (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride?
(4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride has a molecular weight of 199.64 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-phenyl-1,3-oxazolidin-2-one;hydrochloride is sourced from PubChem (CID 171184730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).