C9H8ClI2NO3 — CID 171184780
(4R)-4-(2-hydroxy-3,5-diiodophenyl)-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 171184780) has the molecular formula C9H8ClI2NO3 and a molecular weight of 467.43 g/mol. Its IUPAC name is (4R)-4-(2-hydroxy-3,5-diiodophenyl)-1,3-oxazolidin-2-one;hydrochloride.
| Compound Name | (4R)-4-(2-hydroxy-3,5-diiodophenyl)-1,3-oxazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 171184780 |
| Molecular Formula | C9H8ClI2NO3 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 466.83 |
| IUPAC Name | (4R)-4-(2-hydroxy-3,5-diiodophenyl)-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@H](c2cc(I)cc(I)c2O)CO1 |
| InChI | InChI=1S/C9H7I2NO3.ClH/c10-4-1-5(8(13)6(11)2-4)7-3-15-9(14)12-7;/h1-2,7,13H,3H2,(H,12,14);1H/t7-;/m0./s1 |
| InChIKey | ZHFWRERGXWXGHE-FJXQXJEOSA-N |
| XLogP | 2.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|