About (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride
(4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171184954) has the molecular formula C11H10ClF4NO2
and a molecular weight of 299.65 g/mol. Its IUPAC name is (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride.
Molecular Properties
| Compound Name | (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride |
| PubChem CID | 171184954 |
| Molecular Formula | C11H10ClF4NO2 |
| Molecular Weight | 299.65 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@@H](c2ccc(F)c(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C11H9F4NO2.ClH/c12-8-2-1-6(5-7(8)11(13,14)15)9-3-4-18-10(17)16-9;/h1-2,5,9H,3-4H2,(H,16,17);1H/t9-;/m1./s1 |
| InChIKey | YWTUHKKPJCNWFG-SBSPUUFOSA-N |
| XLogP | 3.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride?
The IUPAC name of (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride (CID 171184954) is (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride.
What is the SMILES notation for (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride?
The canonical SMILES for (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride is Cl.O=C1N[C@@H](c2ccc(F)c(C(F)(F)F)c2)CCO1.
What is the InChIKey of (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride?
The InChIKey is YWTUHKKPJCNWFG-SBSPUUFOSA-N. The full InChI is InChI=1S/C11H9F4NO2.ClH/c12-8-2-1-6(5-7(8)11(13,14)15)9-3-4-18-10(17)16-9;/h1-2,5,9H,3-4H2,(H,16,17);1H/t9-;/m1./s1.
What are the key properties of (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride?
(4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride has a molecular weight of 299.65 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-oxazinan-2-one;hydrochloride is sourced from PubChem (CID 171184954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).