C11H13BrClNO2 — CID 171184970
(4R)-4-(2-bromo-4-methylphenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171184970) has the molecular formula C11H13BrClNO2 and a molecular weight of 306.59 g/mol. Its IUPAC name is (4R)-4-(2-bromo-4-methylphenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-4-(2-bromo-4-methylphenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171184970 |
| Molecular Formula | C11H13BrClNO2 |
| Molecular Weight | 306.59 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | (4R)-4-(2-bromo-4-methylphenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cc1ccc([C@H]2CCOC(=O)N2)c(Br)c1.Cl |
| InChI | InChI=1S/C11H12BrNO2.ClH/c1-7-2-3-8(9(12)6-7)10-4-5-15-11(14)13-10;/h2-3,6,10H,4-5H2,1H3,(H,13,14);1H/t10-;/m1./s1 |
| InChIKey | ZTRJKWPSFGOGOL-HNCPQSOCSA-N |
| XLogP | 3.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |