About (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride
(4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171185446) has the molecular formula C20H16ClNO2
and a molecular weight of 337.81 g/mol. Its IUPAC name is (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride.
Molecular Properties
| Compound Name | (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride |
| PubChem CID | 171185446 |
| Molecular Formula | C20H16ClNO2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@@H](c2ccc3ccc4cccc5ccc2c3c45)CCO1 |
| InChI | InChI=1S/C20H15NO2.ClH/c22-20-21-17(10-11-23-20)15-8-6-14-5-4-12-2-1-3-13-7-9-16(15)19(14)18(12)13;/h1-9,17H,10-11H2,(H,21,22);1H/t17-;/m1./s1 |
| InChIKey | PSPFUMSDRYNMEA-UNTBIKODSA-N |
| XLogP | 5.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride?
The IUPAC name of (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride (CID 171185446) is (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride.
What is the SMILES notation for (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride?
The canonical SMILES for (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride is Cl.O=C1N[C@@H](c2ccc3ccc4cccc5ccc2c3c45)CCO1.
What is the InChIKey of (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride?
The InChIKey is PSPFUMSDRYNMEA-UNTBIKODSA-N. The full InChI is InChI=1S/C20H15NO2.ClH/c22-20-21-17(10-11-23-20)15-8-6-14-5-4-12-2-1-3-13-7-9-16(15)19(14)18(12)13;/h1-9,17H,10-11H2,(H,21,22);1H/t17-;/m1./s1.
What are the key properties of (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride?
(4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride has a molecular weight of 337.81 g/mol, XLogP of 5.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-pyren-1-yl-1,3-oxazinan-2-one;hydrochloride is sourced from PubChem (CID 171185446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).