C10H8F3NO2 — CID 171185725
(4S)-4-(2,3,4-trifluorophenyl)-1,3-oxazinan-2-one (PubChem CID 171185725) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is (4S)-4-(2,3,4-trifluorophenyl)-1,3-oxazinan-2-one.
| Compound Name | (4S)-4-(2,3,4-trifluorophenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171185725 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | (4S)-4-(2,3,4-trifluorophenyl)-1,3-oxazinan-2-one |
| SMILES | O=C1N[C@H](c2ccc(F)c(F)c2F)CCO1 |
| InChI | InChI=1S/C10H8F3NO2/c11-6-2-1-5(8(12)9(6)13)7-3-4-16-10(15)14-7/h1-2,7H,3-4H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | FDQAHLZVQPINDL-ZETCQYMHSA-N |
| XLogP | 2.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|