C12H15ClFNO3 — CID 171186147
(4R)-4-(3-fluoro-2-hydroxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171186147) has the molecular formula C12H15ClFNO3 and a molecular weight of 275.71 g/mol. Its IUPAC name is (4R)-4-(3-fluoro-2-hydroxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-4-(3-fluoro-2-hydroxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171186147 |
| Molecular Formula | C12H15ClFNO3 |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | (4R)-4-(3-fluoro-2-hydroxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one;hydrochloride |
| SMILES | CC1(C)COC(=O)N[C@H]1c1cccc(F)c1O.Cl |
| InChI | InChI=1S/C12H14FNO3.ClH/c1-12(2)6-17-11(16)14-10(12)7-4-3-5-8(13)9(7)15;/h3-5,10,15H,6H2,1-2H3,(H,14,16);1H/t10-;/m0./s1 |
| InChIKey | QNPLCLSXHRRVNF-PPHPATTJSA-N |
| XLogP | 2.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|