C10H10ClF2NO5 — CID 171186274
(4S)-5,5-difluoro-4-(2,3,4-trihydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171186274) has the molecular formula C10H10ClF2NO5 and a molecular weight of 297.64 g/mol. Its IUPAC name is (4S)-5,5-difluoro-4-(2,3,4-trihydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4S)-5,5-difluoro-4-(2,3,4-trihydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171186274 |
| Molecular Formula | C10H10ClF2NO5 |
| Molecular Weight | 297.64 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | (4S)-5,5-difluoro-4-(2,3,4-trihydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@@H](c2ccc(O)c(O)c2O)C(F)(F)CO1 |
| InChI | InChI=1S/C10H9F2NO5.ClH/c11-10(12)3-18-9(17)13-8(10)4-1-2-5(14)7(16)6(4)15;/h1-2,8,14-16H,3H2,(H,13,17);1H/t8-;/m0./s1 |
| InChIKey | UOEIIHWXCSOZEI-QRPNPIFTSA-N |
| XLogP | 1.64 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.64 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|