About (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one
(4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one (PubChem CID 171186285) has the molecular formula C11H10F3NO3
and a molecular weight of 261.20 g/mol. Its IUPAC name is (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one |
| PubChem CID | 171186285 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one |
| SMILES | COc1ccc([C@@H]2NC(=O)OCC2(F)F)c(F)c1 |
| InChI | InChI=1S/C11H10F3NO3/c1-17-6-2-3-7(8(12)4-6)9-11(13,14)5-18-10(16)15-9/h2-4,9H,5H2,1H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | WHDGLJXVEMQCIB-VIFPVBQESA-N |
| XLogP | 2.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one?
The IUPAC name of (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one (CID 171186285) is (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one.
What is the SMILES notation for (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one?
The canonical SMILES for (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one is COc1ccc([C@@H]2NC(=O)OCC2(F)F)c(F)c1.
What is the InChIKey of (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one?
The InChIKey is WHDGLJXVEMQCIB-VIFPVBQESA-N. The full InChI is InChI=1S/C11H10F3NO3/c1-17-6-2-3-7(8(12)4-6)9-11(13,14)5-18-10(16)15-9/h2-4,9H,5H2,1H3,(H,15,16)/t9-/m0/s1.
What are the key properties of (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one?
(4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one has a molecular weight of 261.20 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5,5-difluoro-4-(2-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one is sourced from PubChem (CID 171186285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).