About (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one
(4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one (PubChem CID 171186415) has the molecular formula C12H13ClFNO2
and a molecular weight of 257.69 g/mol. Its IUPAC name is (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one |
| PubChem CID | 171186415 |
| Molecular Formula | C12H13ClFNO2 |
| Molecular Weight | 257.69 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one |
| SMILES | CC1(C)COC(=O)N[C@H]1c1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H13ClFNO2/c1-12(2)6-17-11(16)15-10(12)8-5-7(13)3-4-9(8)14/h3-5,10H,6H2,1-2H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | CYONLMWSODIOFI-JTQLQIEISA-N |
| XLogP | 3.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.69 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one?
The IUPAC name of (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one (CID 171186415) is (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one.
What is the SMILES notation for (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one?
The canonical SMILES for (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one is CC1(C)COC(=O)N[C@H]1c1cc(Cl)ccc1F.
What is the InChIKey of (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one?
The InChIKey is CYONLMWSODIOFI-JTQLQIEISA-N. The full InChI is InChI=1S/C12H13ClFNO2/c1-12(2)6-17-11(16)15-10(12)8-5-7(13)3-4-9(8)14/h3-5,10H,6H2,1-2H3,(H,15,16)/t10-/m0/s1.
What are the key properties of (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one?
(4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one has a molecular weight of 257.69 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(5-chloro-2-fluorophenyl)-5,5-dimethyl-1,3-oxazinan-2-one is sourced from PubChem (CID 171186415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).